* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-L-PHE(3, 5-DIHYDROXY) |
English Synonyms: | FMOC-L-PHE(3, 5-DIHYDROXY) |
MDL Number.: | MFCD01860737 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](Cc4cc(cc(c4)O)O)C(=O)O |
InChi: | InChI=1S/C24H21NO6/c26-15-9-14(10-16(27)12-15)11-22(23(28)29)25-24(30)31-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,12,21-22,26-27H,11,13H2,(H,25,30)(H,28,29)/t22-/m0/s1 |
InChiKey: | InChIKey=IQYDWCWMJOXJIV-QFIPXVFZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.