* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1333675 |
| English Synonyms: | RARECHEM AK MA K071 ; FCHGROUP FCH1333675 |
| MDL Number.: | MFCD01860797 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C(#N)c1c(c2c(c(sc2s1)C#N)O)O |
| InChi: | InChI=1S/C8H2N2O2S2/c9-1-3-6(11)5-7(12)4(2-10)14-8(5)13-3/h11-12H |
| InChiKey: | InChIKey=ZMGGLQCCBZSMHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.