* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-BROMO-3,5-DIFLUOROPHENOL |
CAS: | 325486-43-9 |
English Synonyms: | 2-BROMO-3,5-DIFLUOROPHENOL |
MDL Number.: | MFCD01861127 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1c(cc(c(c1O)Br)F)F |
InChi: | InChI=1S/C6H3BrF2O/c7-6-4(9)1-3(8)2-5(6)10/h1-2,10H |
InChiKey: | InChIKey=AGMQCXYWIMAOMT-UHFFFAOYSA-N |
|
|
Physical Property: | REFRACTIVE INDEX: 1.529 |
Comments: | EINECS: NONE HAZARD: R 36/37/38 HAZARD: S 26-37 IRRITANT TSCA: N UNSPSC: 12352101 |
|
* If the product has intellectual property rights, a license granted is must or contact us.