* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINYL-L-NIO |
| English Synonyms: | L-VNIO ; VINYL-L-NIO ; N5-(1-IMINO-3-BUTENYL)-L-ORNITHINE |
| MDL Number.: | MFCD01862578 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | C=CCC(=N)NCCC[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C9H17N3O2/c1-2-4-8(11)12-6-3-5-7(10)9(13)14/h2,7H,1,3-6,10H2,(H2,11,12)(H,13,14)/t7-/m0/s1 |
| InChiKey: | InChIKey=LMDRHVQXMBGSGU-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.