* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XED |
English Synonyms: | XESTOSPONGIN D ; XED |
MDL Number.: | MFCD01862630 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C1CCC[C@H]2CCN3CCC[C@]([C@H]3O2)(CCCCCC[C@H]4CCN5CCC[C@@H]([C@H]5O4)CC1)O |
InChi: | InChI=1S/C28H50N2O3/c31-28-17-8-4-3-7-13-24-15-21-29-19-9-12-23(26(29)32-24)11-5-1-2-6-14-25-16-22-30(20-10-18-28)27(28)33-25/h23-27,31H,1-22H2/t23-,24-,25-,26+,27+,28-/m0/s1 |
InChiKey: | InChIKey=DAHFKODECRYGAQ-ACWZPJHASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.