* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EICOSATETRAENOIC ACID 8,11,14,17 [1-14C] |
English Synonyms: | EICOSATETRAENOIC ACID 8,11,14,17 [1-14C] |
MDL Number.: | MFCD01862716 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC[13C](=O)O |
InChi: | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13H,2,5,8,11,14-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+,13-12+/i20+1 |
InChiKey: | InChIKey=HQPCSDADVLFHHO-DUOHZCDASA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.