Molecular Structure:
CCD No.:CCD00263694
ETHEPHON [1,2-14C]
Formula:C2 H6 Cl O4 P
MolWeight:164.47
![ETHEPHON [1,2-14C] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | ETHEPHON [1,2-14C] |
| English Synonyms： | ETHEPHON [1,2-14C] |
| MDL Number.： | MFCD01862725 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | [14CH2]([14CH2]Cl)OP(=O)(O)O |
| InChi： | InChI=1S/C2H6ClO4P/c3-1-2-7-8(4,5)6/h1-2H2,(H2,4,5,6)/i1+2,2+2 |
| InChiKey： | InChIKey=ANHAEBWRQNIPEV-XPULMUKRSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
