Molecular Structure:
CCD No.:CCD00263735
GUANOSINE MONOPHOSPHATE, [8-3H]
Formula:C11 H14 N4 O8 P T
MolWeight:364.242
![GUANOSINE MONOPHOSPHATE, [8-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | GUANOSINE MONOPHOSPHATE, [8-3H] |
| English Synonyms： | GUANOSINE MONOPHOSPHATE, [8-3H] |
| MDL Number.： | MFCD01862772 |
| H bond acceptor： | 12 |
| H bond donor： | 6 |
| Smile： | [3H]c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)cc([nH]c2=O)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
