* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8,9,10,11, TETRAHYDRODIBENZ(A,H)ACRIDINE |
| CAS: | 97135-12-1 |
| English Synonyms: | 8,9,10,11, TETRAHYDRODIBENZ(A,H)ACRIDINE |
| MDL Number.: | MFCD01863464 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)ccc3c2cc4ccc5c(c4n3)CCCC5 |
| InChi: | InChI=1S/C21H17N/c1-3-7-17-14(5-1)11-12-20-19(17)13-16-10-9-15-6-2-4-8-18(15)21(16)22-20/h1,3,5,7,9-13H,2,4,6,8H2 |
| InChiKey: | InChIKey=LUBXPQHUZPTKSQ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.