* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-(2,4-DICHLOROBENZYL)-1,3-DIMETHYL-8-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)THIO]-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
English Synonyms: | 7-(2,4-DICHLOROBENZYL)-1,3-DIMETHYL-8-[(4-METHYL-4H-1,2,4-TRIAZOL-3-YL)THIO]-3,7-DIHYDRO-1H-PURINE-2,6-DIONE |
MDL Number.: | MFCD01873688 |
H bond acceptor: | 9 |
H bond donor: | 0 |
Smile: | Cn1cnnc1Sc2nc3c(n2Cc4ccc(cc4Cl)Cl)c(=O)n(c(=O)n3C)C |
InChi: | InChI=1S/C17H15Cl2N7O2S/c1-23-8-20-22-16(23)29-15-21-13-12(14(27)25(3)17(28)24(13)2)26(15)7-9-4-5-10(18)6-11(9)19/h4-6,8H,7H2,1-3H3 |
InChiKey: | InChIKey=XYVUWYIEPVXINL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.