* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035680 |
| English Synonyms: | VITAS-BB TBB035680 |
| MDL Number.: | MFCD01874248 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2=CC=CC=C2F)SC(C(=O)NC2=CC(=CC=C2Cl)C(F)(F)F)=C1C |
| InChi: | InChI=1S/C23H17ClF4N2O4S/c1-3-34-22(33)17-11(2)18(35-21(17)30-19(31)13-6-4-5-7-15(13)25)20(32)29-16-10-12(23(26,27)28)8-9-14(16)24/h4-10H,3H2,1-2H3,(H,29,32)(H,30,31) |
| InChiKey: | InChIKey=KYMBECGGGBBGEI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.