* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035682 |
| English Synonyms: | VITAS-BB TBB035682 |
| MDL Number.: | MFCD01874250 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2=CC=CO2)SC(C(=O)NC2=CC(=CC=C2Cl)C(F)(F)F)=C1C |
| InChi: | InChI=1S/C21H16ClF3N2O5S/c1-3-31-20(30)15-10(2)16(33-19(15)27-17(28)14-5-4-8-32-14)18(29)26-13-9-11(21(23,24)25)6-7-12(13)22/h4-9H,3H2,1-2H3,(H,26,29)(H,27,28) |
| InChiKey: | InChIKey=PAYOVBDFKWMPKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.