* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB015111 |
English Synonyms: | VITAS-BB TBB015111 |
MDL Number.: | MFCD01874806 |
H bond acceptor: | 9 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=O)CC2=CC=C(OC)C=C2)SC(C(=O)NC2=CC=CC=C2C(=O)OCC)=C1C |
InChi: | InChI=1S/C27H28N2O7S/c1-5-35-26(32)19-9-7-8-10-20(19)28-24(31)23-16(3)22(27(33)36-6-2)25(37-23)29-21(30)15-17-11-13-18(34-4)14-12-17/h7-14H,5-6,15H2,1-4H3,(H,28,31)(H,29,30) |
InChiKey: | InChIKey=YXGFWGCLSSYBQE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.