* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035735 |
English Synonyms: | VITAS-BB TBB035735 |
MDL Number.: | MFCD01874809 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=O)C2=CC=CC=C2F)SC(C(=O)NC2=CC=C(OC)C=C2OC)=C1C |
InChi: | InChI=1S/C24H23FN2O6S/c1-5-33-24(30)19-13(2)20(22(29)26-17-11-10-14(31-3)12-18(17)32-4)34-23(19)27-21(28)15-8-6-7-9-16(15)25/h6-12H,5H2,1-4H3,(H,26,29)(H,27,28) |
InChiKey: | InChIKey=VQYCBYKLDSHGIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.