* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB015112 |
English Synonyms: | VITAS-BB TBB015112 |
MDL Number.: | MFCD01874820 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=O)CC2=CC=C(Cl)C=C2)SC(C(=O)NC2=CC=C(OC)C=C2OC)=C1C |
InChi: | InChI=1S/C25H25ClN2O6S/c1-5-34-25(31)21-14(2)22(23(30)27-18-11-10-17(32-3)13-19(18)33-4)35-24(21)28-20(29)12-15-6-8-16(26)9-7-15/h6-11,13H,5,12H2,1-4H3,(H,27,30)(H,28,29) |
InChiKey: | InChIKey=RSEOFHYBWKKNSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.