* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035747 |
English Synonyms: | VITAS-BB TBB035747 |
MDL Number.: | MFCD01874826 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1=C(NC(=O)C2CC2)SC(C(=O)NC2=CC=CC=C2C(=O)OCC)=C1C |
InChi: | InChI=1S/C22H24N2O6S/c1-4-29-21(27)14-8-6-7-9-15(14)23-19(26)17-12(3)16(22(28)30-5-2)20(31-17)24-18(25)13-10-11-13/h6-9,13H,4-5,10-11H2,1-3H3,(H,23,26)(H,24,25) |
InChiKey: | InChIKey=PAJNROVRAIXIHG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.