* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1284993 |
| English Synonyms: | OTAVA-BB 1284993 |
| MDL Number.: | MFCD01874864 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC1=CC(=CC=C1)\N=N\C(\C(N)=O)=C1\NC(C)(C)CC2=C1C=CC=C2 |
| InChi: | InChI=1S/C20H22N4O/c1-13-7-6-9-15(11-13)23-24-18(19(21)25)17-16-10-5-4-8-14(16)12-20(2,3)22-17/h4-11,22H,12H2,1-3H3,(H2,21,25)/b18-17+,24-23+ |
| InChiKey: | InChIKey=HKJVWUIGFHYUNC-QZOSNYCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.