* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 4397323 |
| English Synonyms: | EMOLECULES 4397323 |
| MDL Number.: | MFCD01877627 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C1C[C@@H]1c2ccccc2 |
| InChi: | InChI=1S/C12H14O2/c1-2-14-12(13)11-8-10(11)9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-,11?/m1/s1 |
| InChiKey: | InChIKey=SRGUIJLJERBBCM-NFJWQWPMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.