* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023753 |
| English Synonyms: | VITAS-BB TBB023753 |
| MDL Number.: | MFCD01904690 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC1=C(OCC2=CC=CC=C2)C=CC(\C=N\NS(=O)(=O)C2=CC=C(Cl)C=C2)=C1 |
| InChi: | InChI=1S/C21H19ClN2O4S/c1-27-21-13-17(7-12-20(21)28-15-16-5-3-2-4-6-16)14-23-24-29(25,26)19-10-8-18(22)9-11-19/h2-14,24H,15H2,1H3/b23-14+ |
| InChiKey: | InChIKey=RTDOABAZNYVZMF-OEAKJJBVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.