* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB022890 |
| English Synonyms: | VITAS-BB TBB022890 |
| MDL Number.: | MFCD01906268 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COC1=CC(=CC=C1)C(=O)N\N=C\C1=C(OC)C(OC)=C(OC)C=C1 |
| InChi: | InChI=1S/C18H20N2O5/c1-22-14-7-5-6-12(10-14)18(21)20-19-11-13-8-9-15(23-2)17(25-4)16(13)24-3/h5-11H,1-4H3,(H,20,21)/b19-11+ |
| InChiKey: | InChIKey=RMURBUHBXMEALJ-YBFXNURJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.