* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 2377895 |
| English Synonyms: | EMOLECULES 2377895 |
| MDL Number.: | MFCD01909620 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1c2c(cc3c1OCCO3)[nH]cc(c2=O)C(=O)O |
| InChi: | InChI=1S/C12H9NO5/c14-11-6-3-9-10(18-2-1-17-9)4-8(6)13-5-7(11)12(15)16/h3-5H,1-2H2,(H,13,14)(H,15,16) |
| InChiKey: | InChIKey=MHIFATZXRQSTSN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.