* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB018024 |
| English Synonyms: | VITAS-BB TBB018024 |
| MDL Number.: | MFCD01912829 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC1=C(OCC2=CC=CC=C2)C=CC(\C=N/NC(=O)C2=CC=CO2)=C1 |
| InChi: | InChI=1S/C20H18N2O4/c1-24-19-12-16(13-21-22-20(23)18-8-5-11-25-18)9-10-17(19)26-14-15-6-3-2-4-7-15/h2-13H,14H2,1H3,(H,22,23)/b21-13- |
| InChiKey: | InChIKey=QFHPRIZRMDDZFE-BKUYFWCQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.