* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 1861851 |
English Synonyms: | EMOLECULES 1861851 |
MDL Number.: | MFCD01918614 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(c(c(c1Cl)Cn2c(=O)c(c(cn2)Cl)Cl)Cl)Cl |
InChi: | InChI=1S/C11H5Cl5N2O/c12-6-1-2-7(13)9(15)5(6)4-18-11(19)10(16)8(14)3-17-18/h1-3H,4H2 |
InChiKey: | InChIKey=WJCBNLYRBWYSDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.