* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024441 |
| English Synonyms: | VITAS-BB TBB024441 |
| MDL Number.: | MFCD01920107 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | ClC1=CC=C(Cl)C(=C1)S(=O)(=O)NC1=CC(NS(=O)(=O)C2=CC(Cl)=CC=C2Cl)=CC=C1 |
| InChi: | InChI=1S/C18H12Cl4N2O4S2/c19-11-4-6-15(21)17(8-11)29(25,26)23-13-2-1-3-14(10-13)24-30(27,28)18-9-12(20)5-7-16(18)22/h1-10,23-24H |
| InChiKey: | InChIKey=QTLGEPDUYDDQTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.