* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023701 |
| English Synonyms: | VITAS-BB TBB023701 |
| MDL Number.: | MFCD01921130 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CC1=CC(NC(=O)C2=CC=CC(=N2)C(=O)NC2=NOC(C)=C2)=NO1 |
| InChi: | InChI=1S/C15H13N5O4/c1-8-6-12(19-23-8)17-14(21)10-4-3-5-11(16-10)15(22)18-13-7-9(2)24-20-13/h3-7H,1-2H3,(H,17,19,21)(H,18,20,22) |
| InChiKey: | InChIKey=OFSAHSNPZGJTJC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.