* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021727 |
| English Synonyms: | VITAS-BB TBB021727 |
| MDL Number.: | MFCD01921224 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC(=O)C1=C(C)C(C(=O)OC)=C(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S1 |
| InChi: | InChI=1S/C14H10F9NO5S/c1-4-5(8(25)28-2)7(30-6(4)9(26)29-3)24-10(27)11(15,16)12(17,18)13(19,20)14(21,22)23/h1-3H3,(H,24,27) |
| InChiKey: | InChIKey=YDYSXHJJIUEDAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.