* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024760 |
| English Synonyms: | VITAS-BB TBB024760 |
| MDL Number.: | MFCD01921255 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | O=C(N\N=C\C1=CC=CC2=C1C=CC=C2)C1=CC=C(O1)C(=O)N\N=C\C1=CC=CC2=C1C=CC=C2 |
| InChi: | InChI=1S/C28H20N4O3/c33-27(31-29-17-21-11-5-9-19-7-1-3-13-23(19)21)25-15-16-26(35-25)28(34)32-30-18-22-12-6-10-20-8-2-4-14-24(20)22/h1-18H,(H,31,33)(H,32,34)/b29-17+,30-18+ |
| InChiKey: | InChIKey=AMGLBHLWMCYDBH-YAGSLNJISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.