* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB024761 |
| English Synonyms: | VITAS-BB TBB024761 |
| MDL Number.: | MFCD01921360 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | COC1=CC=C(\C=N\NC(=O)C2=CC=C(O2)C(=O)N\N=C\C2=CC=C(OC)C=C2)C=C1 |
| InChi: | InChI=1S/C22H20N4O5/c1-29-17-7-3-15(4-8-17)13-23-25-21(27)19-11-12-20(31-19)22(28)26-24-14-16-5-9-18(30-2)10-6-16/h3-14H,1-2H3,(H,25,27)(H,26,28)/b23-13+,24-14+ |
| InChiKey: | InChIKey=RTDKKGHCIUUTID-RNIAWFEPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.