* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016909 |
| English Synonyms: | VITAS-BB TBB016909 |
| MDL Number.: | MFCD01921385 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | COC1=CC(\C=N\NC(=O)CCC(=O)N\N=C\C2=CC(Br)=C(O)C(OC)=C2)=CC(Br)=C1O |
| InChi: | InChI=1S/C20H20Br2N4O6/c1-31-15-7-11(5-13(21)19(15)29)9-23-25-17(27)3-4-18(28)26-24-10-12-6-14(22)20(30)16(8-12)32-2/h5-10,29-30H,3-4H2,1-2H3,(H,25,27)(H,26,28)/b23-9+,24-10+ |
| InChiKey: | InChIKey=VPUZUQIFVGPWCV-WDBPGAOMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.