* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021331 |
| English Synonyms: | VITAS-BB TBB021331 |
| MDL Number.: | MFCD01922183 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2C(C(O)=O)C3(Cl)C(Cl)=C(Cl)C2(Cl)C3(Cl)Cl)SC(C)=C1C1=CC=CC=C1 |
| InChi: | InChI=1S/C23H17Cl6NO5S/c1-3-35-20(34)12-11(10-7-5-4-6-8-10)9(2)36-18(12)30-17(31)13-14(19(32)33)22(27)16(25)15(24)21(13,26)23(22,28)29/h4-8,13-14H,3H2,1-2H3,(H,30,31)(H,32,33) |
| InChiKey: | InChIKey=HPEHDEVGSXYWMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.