* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021258 |
| English Synonyms: | VITAS-BB TBB021258 |
| MDL Number.: | MFCD01922217 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1CCC\C(C1)=N\NC(=O)C1=C2C=CC=CC2=NC(=C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C23H23N3O/c1-16-8-7-11-18(14-16)25-26-23(27)20-15-22(17-9-3-2-4-10-17)24-21-13-6-5-12-19(20)21/h2-6,9-10,12-13,15-16H,7-8,11,14H2,1H3,(H,26,27)/b25-18- |
| InChiKey: | InChIKey=FXDPRHREASGHJY-BWAHOGKJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.