* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020999 |
| English Synonyms: | VITAS-BB TBB020999 |
| MDL Number.: | MFCD01922571 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCC(CC)C(=O)C1=CC=C(C=C1)C(\C)=N/NC(=O)C1=CC2=C(OCO2)C=C1 |
| InChi: | InChI=1S/C22H24N2O4/c1-4-15(5-2)21(25)17-8-6-16(7-9-17)14(3)23-24-22(26)18-10-11-19-20(12-18)28-13-27-19/h6-12,15H,4-5,13H2,1-3H3,(H,24,26)/b23-14- |
| InChiKey: | InChIKey=ZIBOBEBMUBCZMN-UCQKPKSFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.