* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB017629 |
| English Synonyms: | VITAS-BB TBB017629 |
| MDL Number.: | MFCD01922588 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC1=CC2=C(C=C1)C(Cl)=C(S2)C(=O)N\N=C\C(\Cl)=C(/Cl)C(O)=O |
| InChi: | InChI=1S/C14H9Cl3N2O3S/c1-6-2-3-7-9(4-6)23-12(10(7)16)13(20)19-18-5-8(15)11(17)14(21)22/h2-5H,1H3,(H,19,20)(H,21,22)/b11-8+,18-5+ |
| InChiKey: | InChIKey=YGKOMJVBJCLEQT-NWYCUQECSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.