* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020979 |
| English Synonyms: | VITAS-BB TBB020979 |
| MDL Number.: | MFCD01922747 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COC(=O)C1=C(NC(=O)C2=CC(=NC3=C2C=CC=C3)C2=CC=C(CC(C)C)C=C2)SC(C)=C1C |
| InChi: | InChI=1S/C28H28N2O3S/c1-16(2)14-19-10-12-20(13-11-19)24-15-22(21-8-6-7-9-23(21)29-24)26(31)30-27-25(28(32)33-5)17(3)18(4)34-27/h6-13,15-16H,14H2,1-5H3,(H,30,31) |
| InChiKey: | InChIKey=KHNFWMLKGXWWPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.