* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021355 |
| English Synonyms: | VITAS-BB TBB021355 |
| MDL Number.: | MFCD01922952 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COC(=O)C1=C(NC(=O)C2=CC=C(OC(C)C)C=C2)SC2=C1CCC(C2)C1=CC=CC=C1 |
| InChi: | InChI=1S/C26H27NO4S/c1-16(2)31-20-12-9-18(10-13-20)24(28)27-25-23(26(29)30-3)21-14-11-19(15-22(21)32-25)17-7-5-4-6-8-17/h4-10,12-13,16,19H,11,14-15H2,1-3H3,(H,27,28) |
| InChiKey: | InChIKey=SEXPHVUDCIXOLT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.