* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021336 |
| English Synonyms: | VITAS-BB TBB021336 |
| MDL Number.: | MFCD01922990 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC(=O)C1=C(NC(=O)CCCC(O)=O)SC2=C1CCC(C2)C1=CC=CC=C1 |
| InChi: | InChI=1S/C21H23NO5S/c1-27-21(26)19-15-11-10-14(13-6-3-2-4-7-13)12-16(15)28-20(19)22-17(23)8-5-9-18(24)25/h2-4,6-7,14H,5,8-12H2,1H3,(H,22,23)(H,24,25) |
| InChiKey: | InChIKey=HSYPMXNKYQOIDA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.