* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020938 |
| English Synonyms: | VITAS-BB TBB020938 |
| MDL Number.: | MFCD01923214 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COC(=O)C1=C(NC(=O)C2=CC(=NC3=C2C=CC=C3)C2=CC=C(C=C2)C(C)C)SC2=C1CCC(C2)C1=CC=CC=C1 |
| InChi: | InChI=1S/C35H32N2O3S/c1-21(2)22-13-15-24(16-14-22)30-20-28(26-11-7-8-12-29(26)36-30)33(38)37-34-32(35(39)40-3)27-18-17-25(19-31(27)41-34)23-9-5-4-6-10-23/h4-16,20-21,25H,17-19H2,1-3H3,(H,37,38) |
| InChiKey: | InChIKey=MILBPNHNDDDSKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.