* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021307 |
| English Synonyms: | VITAS-BB TBB021307 |
| MDL Number.: | MFCD01923374 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CCN1CCC2(CC1)NC(CO)(CO)CO2 |
| InChi: | InChI=1S/C11H22N2O3/c1-2-13-5-3-11(4-6-13)12-10(7-14,8-15)9-16-11/h12,14-15H,2-9H2,1H3 |
| InChiKey: | InChIKey=IMUXYDQGHXGNFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.