* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB021332 |
| English Synonyms: | VITAS-BB TBB021332 |
| MDL Number.: | MFCD01923383 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC1=CC=C(C=C1)C1=CSC(NC(=O)C2C3CCC(C3)C2C(O)=O)=N1 |
| InChi: | InChI=1S/C19H20N2O3S/c1-10-2-4-11(5-3-10)14-9-25-19(20-14)21-17(22)15-12-6-7-13(8-12)16(15)18(23)24/h2-5,9,12-13,15-16H,6-8H2,1H3,(H,23,24)(H,20,21,22) |
| InChiKey: | InChIKey=IYUWYFPSPMFUOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.