* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020929 |
| English Synonyms: | VITAS-BB TBB020929 |
| MDL Number.: | MFCD01923396 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC1=CC=C(OC)C(NC(=O)C2C3CCC(C2C(O)=O)C3=C(C)C)=C1 |
| InChi: | InChI=1S/C20H25NO5/c1-10(2)16-12-6-7-13(16)18(20(23)24)17(12)19(22)21-14-9-11(25-3)5-8-15(14)26-4/h5,8-9,12-13,17-18H,6-7H2,1-4H3,(H,21,22)(H,23,24) |
| InChiKey: | InChIKey=VXFWUBASHMOLJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.