* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 2128834 |
English Synonyms: | EMOLECULES 2128834 |
MDL Number.: | MFCD01923572 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CCN1CCc2c(sc(c2C(=O)N)NC(=O)Nc3ccc(cc3)Cl)C1 |
InChi: | InChI=1S/C17H19ClN4O2S/c1-2-22-8-7-12-13(9-22)25-16(14(12)15(19)23)21-17(24)20-11-5-3-10(18)4-6-11/h3-6H,2,7-9H2,1H3,(H2,19,23)(H2,20,21,24) |
InChiKey: | InChIKey=QBLKUVUKIZEWAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.