* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB021646 |
English Synonyms: | VITAS-BB TBB021646 |
MDL Number.: | MFCD01924154 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCCCOC1=CC=C(C=C1)C(=O)N\N=C\C(C)CC1=CC=C2OCOC2=C1 |
InChi: | InChI=1S/C22H26N2O4/c1-3-4-11-26-19-8-6-18(7-9-19)22(25)24-23-14-16(2)12-17-5-10-20-21(13-17)28-15-27-20/h5-10,13-14,16H,3-4,11-12,15H2,1-2H3,(H,24,25)/b23-14+ |
InChiKey: | InChIKey=WEWCCFGLMNKOCV-OEAKJJBVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.