* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMIDAZO[2,1-B]THIAZOLE |
| CAS: | 251-97-8 |
| English Synonyms: | IMIDAZO[2,1-B][1,3]THIAZOLE ; IMIDAZO[2,1-B]THIAZOLE |
| MDL Number.: | MFCD01924763 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cn2ccsc2n1 |
| InChi: | InChI=1S/C5H4N2S/c1-2-7-3-4-8-5(7)6-1/h1-4H |
| InChiKey: | InChIKey=UFBBWLWUIISIPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.