* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 13728619 |
English Synonyms: | SPECS 601/30963015 ; EMOLECULES 13728619 |
MDL Number.: | MFCD01924786 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1cn2ccsc2[n+]1C |
InChi: | InChI=1S/C7H9N2S/c1-6-5-9-3-4-10-7(9)8(6)2/h3-5H,1-2H3/q+1 |
InChiKey: | InChIKey=GVQMKAUUEGFJNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.