* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 13728619 |
| English Synonyms: | EMOLECULES 13728619 ; SPECS 601/30963015 |
| MDL Number.: | MFCD01924786 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | Cc1cn2ccsc2[n+]1C |
| InChi: | InChI=1S/C7H9N2S/c1-6-5-9-3-4-10-7(9)8(6)2/h3-5H,1-2H3/q+1 |
| InChiKey: | InChIKey=GVQMKAUUEGFJNY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.