* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 2934141 |
| English Synonyms: | EMOLECULES 2934141 |
| MDL Number.: | MFCD01925547 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CC(C)(CC(=O)Nc1c(c(cs1)c2cccs2)C(=O)O)CC(=O)Nc3c(c(cs3)c4cccs4)C(=O)O |
| InChi: | InChI=1S/C25H22N2O6S4/c1-25(2,9-17(28)26-21-19(23(30)31)13(11-36-21)15-5-3-7-34-15)10-18(29)27-22-20(24(32)33)14(12-37-22)16-6-4-8-35-16/h3-8,11-12H,9-10H2,1-2H3,(H,26,28)(H,27,29)(H,30,31)(H,32,33) |
| InChiKey: | InChIKey=YUHQZBFHEDBIRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.