* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 9948941 |
English Synonyms: | EMOLECULES 9948941 |
MDL Number.: | MFCD01931730 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCN(CC)C1C(=Nc2ccccc2NC1=O)c3ccccc3 |
InChi: | InChI=1S/C19H21N3O/c1-3-22(4-2)18-17(14-10-6-5-7-11-14)20-15-12-8-9-13-16(15)21-19(18)23/h5-13,18H,3-4H2,1-2H3,(H,21,23) |
InChiKey: | InChIKey=DXPMIYLUPGQMOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.