* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,7-DIMETHYL-4-(4-METHYLPHENYL)-4,6,7,8-TETRAHYDRO-2H-CHROMENE-2,5(3H)-DIONE |
| English Synonyms: | 7,7-DIMETHYL-4-(4-METHYLPHENYL)-4,6,7,8-TETRAHYDRO-2H-CHROMENE-2,5(3H)-DIONE |
| MDL Number.: | MFCD01936343 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cc1)C2CC(=O)OC3=C2C(=O)CC(C3)(C)C |
| InChi: | InChI=1S/C18H20O3/c1-11-4-6-12(7-5-11)13-8-16(20)21-15-10-18(2,3)9-14(19)17(13)15/h4-7,13H,8-10H2,1-3H3 |
| InChiKey: | InChIKey=JRUAAYSVGCPOKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.