* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-ETHYL-5-OXO-2,3,6,7-TETRAHYDRO-5H-THIAZOLO(3,2-A)PYRIMIDINE |
| CAS: | 39567-23-2 |
| English Synonyms: | 7-ETHYL-5-OXO-2,3,6,7-TETRAHYDRO-5H-THIAZOLO(3,2-A)PYRIMIDINE ; 7-ETHYL-2H,3H,5H,6H,7H-[1,3]THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| MDL Number.: | MFCD01939221 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCC1CC(=O)N2CCSC2=N1 |
| InChi: | InChI=1S/C8H12N2OS/c1-2-6-5-7(11)10-3-4-12-8(10)9-6/h6H,2-5H2,1H3 |
| InChiKey: | InChIKey=MXUQQHNDCAKLIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.