* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ANTIBIOTIC PS 7 |
CAS: | 72615-18-0 |
English Synonyms: | ANTIBIOTIC PS 7 |
MDL Number.: | MFCD01939387 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC[C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)O)S/C=C/NC(=O)C |
InChi: | InChI=1S/C13H16N2O4S/c1-3-8-9-6-10(20-5-4-14-7(2)16)11(13(18)19)15(9)12(8)17/h4-5,8-9H,3,6H2,1-2H3,(H,14,16)(H,18,19)/b5-4+/t8-,9-/m1/s1 |
InChiKey: | InChIKey=PQZKMTPCUYSWBM-HOMPQPGZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.