* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OA-6129A |
| CAS: | 82475-11-4 |
| English Synonyms: | OA-6129A |
| MDL Number.: | MFCD01939393 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | CC[C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO)O |
| InChi: | InChI=1S/C20H31N3O7S/c1-4-11-12-9-13(15(19(29)30)23(12)18(11)28)31-8-7-21-14(25)5-6-22-17(27)16(26)20(2,3)10-24/h11-12,16,24,26H,4-10H2,1-3H3,(H,21,25)(H,22,27)(H,29,30)/t11-,12-,16+/m1/s1 |
| InChiKey: | InChIKey=AWQOXZYWBFPMRH-HSMVNMDESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.